Protein Modification Reagents
![eMolecules 2855229-28-4 | Hydroxy-PEG1-acid sodium salt | Broadpharm156.113 | C5H9NaO4 | 0.000 | [Na+].OCCOCCC([O-])=O | 1g | 761707322](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502474089.JPG-250.jpg)
eMolecules 2855229-28-4 | Hydroxy-PEG1-acid sodium salt | Broadpharm156.113 | C5H9NaO4 | 0.000 | [Na+].OCCOCCC([O-])=O | 1g | 761707322
Hydroxy-PEG1-acid sodium salt | Broadpharm | 2855229-28-4156.113 | C5H9NaO4 | 0.000 | [Na+].OCCOCCC([O-])=O | 1g | 761707322
eMolecules 557756-85-1 | Fmoc-NH-PEG4-CH2CH2COOH | ChemScene | MFCD06656472 | 487.549 | C26H33NO8 | 96.000 | OC(=O)CCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572227290
Fmoc-NH-PEG4-CH2CH2COOH | ChemScene | 557756-85-1 | MFCD06656472 | 487.549 | C26H33NO8 | 96.000 | OC(=O)CCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572227290
![eMolecules 7-O-(Bromoacetamido-PEG4)- paclitaxel | Broadpharm |1222.142 | C60H73BrN2O20 | 95.000 | CC(=O)O[C@@H]1C2=C(C)[C@H](C[C@@](O)([C@@H](OC(=O)c3ccccc3)C3[C@@]4(CO[C@@H]4C[C@H](OC(=O)CCOCCOCCOCCOCCNC(=O)CBr)[C@@]3(C)C1=O)OC(C)=O)C2(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1 | 10mg ...](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502183502.JPG-250.jpg)
eMolecules 7-O-(Bromoacetamido-PEG4)- paclitaxel | Broadpharm |1222.142 | C60H73BrN2O20 | 95.000 | CC(=O)O[C@@H]1C2=C(C)[C@H](C[C@@](O)([C@@H](OC(=O)c3ccccc3)C3[C@@]4(CO[C@@H]4C[C@H](OC(=O)CCOCCOCCOCCOCCNC(=O)CBr)[C@@]3(C)C1=O)OC(C)=O)C2(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1 | 10mg ...
7-O-(Bromoacetamido-PEG4)- paclitaxel | Broadpharm |1222.142 | C60H73BrN2O20 | 95.000 | CC(=O)O[C@@H]1C2=C(C)[C@H](C[C@@](O)([C@@H](OC(=O)c3ccccc3)C3[C@@]4(CO[C@@H]4C[C@H](OC(=O)CCOCCOCCOCCOCCNC(=O)CBr)[C@@]3(C)C1=O)OC(C)=O)C2(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1 | 10mg | 550804560
eMolecules 2279944-66-8 | N,N-diethanol amine-PEG4-tert-butyl ester | Broadpharm409.520 | C19H39NO8 | 0.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCN(CCO)CCO | 1g | 550804567
N,N-diethanol amine-PEG4-tert-butyl ester | Broadpharm | 2279944-66-8409.520 | C19H39NO8 | 0.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCN(CCO)CCO | 1g | 550804567
eMolecules Bis-Bromoacetamido-PEG11 | Broadpharm |786.549 | C28H54Br2N2O13 | 0.000 | BrCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CBr | 250mg | 550804565
Bis-Bromoacetamido-PEG11 | Broadpharm |786.549 | C28H54Br2N2O13 | 0.000 | BrCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CBr | 250mg | 550804565
![eMolecules 2354291-37-3 | Gly-PEG3-endo-BCN | Broadpharm453.580 | C23H39N3O6 | 0.000 | NCC(=O)NCCCOCCOCCOCCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 100mg | 550804569](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502183536.JPG-250.jpg)
eMolecules 2354291-37-3 | Gly-PEG3-endo-BCN | Broadpharm453.580 | C23H39N3O6 | 0.000 | NCC(=O)NCCCOCCOCCOCCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 100mg | 550804569
Gly-PEG3-endo-BCN | Broadpharm | 2354291-37-3453.580 | C23H39N3O6 | 0.000 | NCC(=O)NCCCOCCOCCOCCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 100mg | 550804569
Avanti Polar Lipids DSPE-PEG(2000) MALEIMIDE 25MGD
1,2-distearoyl-sn-glycero-3-phosphoethanolamine-N-[maleimide(polyethylene glycol)-2000] (ammonium salt). 474922-22-0
eMolecules 2512227-27-7 | Iodoacetamido-PEG3-NHS ester | Broadpharm486.259 | C15H23IN2O8 | 95.000 | ICC(=O)NCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O | 50mg | 784455349
Iodoacetamido-PEG3-NHS ester | Broadpharm | 2512227-27-7486.259 | C15H23IN2O8 | 95.000 | ICC(=O)NCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O | 50mg | 784455349
eMolecules DBCO-PEG8-amine TFA salt | Broadpharm |699.842 | C37H53N3O10 | 0.000 | NCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc12 | 50mg | 698442848
DBCO-PEG8-amine TFA salt | Broadpharm |699.842 | C37H53N3O10 | 0.000 | NCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc12 | 50mg | 698442848
Medchemexpress LLC (S,R,S)-AHPC-PEG2-NH2 | 2010159-60-9 | 95.4% | 575.72 g·mol⁻¹ | C28H41N5O6S | 50 MG
(S,R,S)-AHPC-PEG2-NH2 is an E3 ligase VHL ligand-linker conjugate that links an (S,R,S)-configured AHPC VHL ligand to a two-unit polyethylene glycol (PEG2) spacer ending in a primary amine, used as a building block in PROTAC synthesis.
- VHL ligand-linker conjugate for targeted protein degradation research.
- Contains an (S,R,S)-configured AHPC VHL ligand.
- Features a two-unit PEG linker terminating in a primary amine for conjugation.
- Provided as a free base solid, typically white to yellow.
- Available in small research pack sizes suitable for synthesis workflows.
- High reported purity appropriate for medicinal chemistry and probe synthesis.
Medchemexpress LLC Mal-amido-PEG8-NHS ester | 756525-93-6 | MFCD11041144 | 99.2% | 689.71 g/mol | C30H47N3O15 | 50 MG
Mal-amido-PEG8-NHS ester is a bifunctional PEG-based linker bearing a maleimide and an NHS ester. It is designed for bioconjugation workflows to connect thiol- and amine-containing molecules, enabling assembly of PROTACs, antibody drug conjugates, and other conjugates. The PEG8 spacer improves solubility and flexibility, while the reactive termini support efficient, site-selective coupling.
eMolecules Methyltetrazine-PEG24-t-butyl ester | Broadpharm |1373.633 | C64H116N4O27 | 95.000 | Cc1nnc(nn1)-c1ccc(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C)cc1 | 5mg | 393649431
Methyltetrazine-PEG24-t-butyl ester | Broadpharm |1373.633 | C64H116N4O27 | 95.000 | Cc1nnc(nn1)-c1ccc(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C)cc1 | 5mg | 393649431